About 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate (PubChem CID 104562931) has the molecular formula C14H20BrNO5
and a molecular weight of 362.22 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate |
| PubChem CID | 104562931 |
| Molecular Formula | C14H20BrNO5 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate |
| SMILES | COCCOCCOCCOC(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C14H20BrNO5/c1-18-4-5-19-6-7-20-8-9-21-14(17)12-3-2-11(15)10-13(12)16/h2-3,10H,4-9,16H2,1H3 |
| InChIKey | OULXWZVJMYULIP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate (CID 104562931) is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate is COCCOCCOCCOC(=O)c1ccc(Br)cc1N.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate?
The InChIKey is OULXWZVJMYULIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO5/c1-18-4-5-19-6-7-20-8-9-21-14(17)12-3-2-11(15)10-13(12)16/h2-3,10H,4-9,16H2,1H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate?
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate has a molecular weight of 362.22 g/mol, XLogP of 1.87, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-amino-4-bromobenzoate is sourced from PubChem (CID 104562931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).