C15H23NO4 — CID 103179344
2-(3-methoxypropoxy)ethyl 5-amino-2,4-dimethylbenzoate (PubChem CID 103179344) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 5-amino-2,4-dimethylbenzoate.
| Compound Name | 2-(3-methoxypropoxy)ethyl 5-amino-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 103179344 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl 5-amino-2,4-dimethylbenzoate |
| SMILES | COCCCOCCOC(=O)c1cc(N)c(C)cc1C |
| InChI | InChI=1S/C15H23NO4/c1-11-9-12(2)14(16)10-13(11)15(17)20-8-7-19-6-4-5-18-3/h9-10H,4-8,16H2,1-3H3 |
| InChIKey | KWWLCVVLPLKYFL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|