About 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate
2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate (PubChem CID 112548868) has the molecular formula C12H16INO4
and a molecular weight of 365.17 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate |
| PubChem CID | 112548868 |
| Molecular Formula | C12H16INO4 |
| Molecular Weight | 365.17 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate |
| SMILES | COCCOCCOC(=O)c1cc(I)ccc1N |
| InChI | InChI=1S/C12H16INO4/c1-16-4-5-17-6-7-18-12(15)10-8-9(13)2-3-11(10)14/h2-3,8H,4-7,14H2,1H3 |
| InChIKey | LQIJPRPNMBHIHH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate (CID 112548868) is 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate is COCCOCCOC(=O)c1cc(I)ccc1N.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate?
The InChIKey is LQIJPRPNMBHIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16INO4/c1-16-4-5-17-6-7-18-12(15)10-8-9(13)2-3-11(10)14/h2-3,8H,4-7,14H2,1H3.
What are the key properties of 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate?
2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate has a molecular weight of 365.17 g/mol, XLogP of 1.69, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl 2-amino-5-iodobenzoate is sourced from PubChem (CID 112548868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).