About azane;methyl 2-amino-5-iodobenzoate
azane;methyl 2-amino-5-iodobenzoate (PubChem CID 122622802) has the molecular formula C8H11IN2O2
and a molecular weight of 294.09 g/mol. Its IUPAC name is azane;methyl 2-amino-5-iodobenzoate.
Molecular Properties
| Compound Name | azane;methyl 2-amino-5-iodobenzoate |
| PubChem CID | 122622802 |
| Molecular Formula | C8H11IN2O2 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | azane;methyl 2-amino-5-iodobenzoate |
| SMILES | COC(=O)c1cc(I)ccc1N.N |
| InChI | InChI=1S/C8H8INO2.H3N/c1-12-8(11)6-4-5(9)2-3-7(6)10;/h2-4H,10H2,1H3;1H3 |
| InChIKey | WMUXMAIVFOABTO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl 2-amino-5-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl 2-amino-5-iodobenzoate?
The IUPAC name of azane;methyl 2-amino-5-iodobenzoate (CID 122622802) is azane;methyl 2-amino-5-iodobenzoate.
What is the SMILES notation for azane;methyl 2-amino-5-iodobenzoate?
The canonical SMILES for azane;methyl 2-amino-5-iodobenzoate is COC(=O)c1cc(I)ccc1N.N.
What is the InChIKey of azane;methyl 2-amino-5-iodobenzoate?
The InChIKey is WMUXMAIVFOABTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO2.H3N/c1-12-8(11)6-4-5(9)2-3-7(6)10;/h2-4H,10H2,1H3;1H3.
What are the key properties of azane;methyl 2-amino-5-iodobenzoate?
azane;methyl 2-amino-5-iodobenzoate has a molecular weight of 294.09 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl 2-amino-5-iodobenzoate is sourced from PubChem (CID 122622802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).