About methyl 2-amino-5-bromobenzoate;hydrobromide
methyl 2-amino-5-bromobenzoate;hydrobromide (PubChem CID 162716594) has the molecular formula C8H9Br2NO2
and a molecular weight of 310.97 g/mol. Its IUPAC name is methyl 2-amino-5-bromobenzoate;hydrobromide.
Molecular Properties
| Compound Name | methyl 2-amino-5-bromobenzoate;hydrobromide |
| PubChem CID | 162716594 |
| Molecular Formula | C8H9Br2NO2 |
| Molecular Weight | 310.97 g/mol |
| Exact Mass | 308.90 |
| IUPAC Name | methyl 2-amino-5-bromobenzoate;hydrobromide |
| SMILES | Br.COC(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C8H8BrNO2.BrH/c1-12-8(11)6-4-5(9)2-3-7(6)10;/h2-4H,10H2,1H3;1H |
| InChIKey | JXRSQGOXFTVRLQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.97 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-5-bromobenzoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-5-bromobenzoate;hydrobromide?
The IUPAC name of methyl 2-amino-5-bromobenzoate;hydrobromide (CID 162716594) is methyl 2-amino-5-bromobenzoate;hydrobromide.
What is the SMILES notation for methyl 2-amino-5-bromobenzoate;hydrobromide?
The canonical SMILES for methyl 2-amino-5-bromobenzoate;hydrobromide is Br.COC(=O)c1cc(Br)ccc1N.
What is the InChIKey of methyl 2-amino-5-bromobenzoate;hydrobromide?
The InChIKey is JXRSQGOXFTVRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2.BrH/c1-12-8(11)6-4-5(9)2-3-7(6)10;/h2-4H,10H2,1H3;1H.
What are the key properties of methyl 2-amino-5-bromobenzoate;hydrobromide?
methyl 2-amino-5-bromobenzoate;hydrobromide has a molecular weight of 310.97 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-5-bromobenzoate;hydrobromide is sourced from PubChem (CID 162716594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).