C20H29IO6 — CID 125479234
bis(2-butoxyethyl) 4-iodobenzene-1,2-dicarboxylate (PubChem CID 125479234) has the molecular formula C20H29IO6 and a molecular weight of 492.35 g/mol. Its IUPAC name is bis(2-butoxyethyl) 4-iodobenzene-1,2-dicarboxylate.
| Compound Name | bis(2-butoxyethyl) 4-iodobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 125479234 |
| Molecular Formula | C20H29IO6 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | bis(2-butoxyethyl) 4-iodobenzene-1,2-dicarboxylate |
| SMILES | CCCCOCCOC(=O)c1ccc(I)cc1C(=O)OCCOCCCC |
| InChI | InChI=1S/C20H29IO6/c1-3-5-9-24-11-13-26-19(22)17-8-7-16(21)15-18(17)20(23)27-14-12-25-10-6-4-2/h7-8,15H,3-6,9-14H2,1-2H3 |
| InChIKey | RBOXEVYHBQVKJK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|