C22H34O7 — CID 141493838
2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxycarbonyl]benzoic acid (PubChem CID 141493838) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxycarbonyl]benzoic acid.
| Compound Name | 2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 141493838 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxycarbonyl]benzoic acid |
| SMILES | CCCCCCCCOCCOCCOCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H34O7/c1-2-3-4-5-6-9-12-26-13-14-27-15-16-28-17-18-29-22(25)20-11-8-7-10-19(20)21(23)24/h7-8,10-11H,2-6,9,12-18H2,1H3,(H,23,24) |
| InChIKey | AVGQMAYNPVJBBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|