C22H34O6 — CID 170841279
1-O-decyl 2-O-[2-(2-hydroxyethoxy)ethyl] benzene-1,2-dicarboxylate (PubChem CID 170841279) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1-O-decyl 2-O-[2-(2-hydroxyethoxy)ethyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-decyl 2-O-[2-(2-hydroxyethoxy)ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170841279 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-O-decyl 2-O-[2-(2-hydroxyethoxy)ethyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCOCCO |
| InChI | InChI=1S/C22H34O6/c1-2-3-4-5-6-7-8-11-15-27-21(24)19-12-9-10-13-20(19)22(25)28-18-17-26-16-14-23/h9-10,12-13,23H,2-8,11,14-18H2,1H3 |
| InChIKey | RAESJFIIGIPOQS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|