C26H44O6 — CID 19013740
dioctyl benzene-1,2-dicarboxylate;ethane-1,2-diol (PubChem CID 19013740) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;ethane-1,2-diol.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;ethane-1,2-diol |
|---|---|
| PubChem CID | 19013740 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;ethane-1,2-diol |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.OCCO |
| InChI | InChI=1S/C24H38O4.C2H6O2/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;3-1-2-4/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;3-4H,1-2H2 |
| InChIKey | CKMDHRJWHNGDND-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|