C20H32O7 — CID 21326814
dibutyl benzene-1,2-dicarboxylate;2-(2-hydroxyethoxy)ethanol (PubChem CID 21326814) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is dibutyl benzene-1,2-dicarboxylate;2-(2-hydroxyethoxy)ethanol.
| Compound Name | dibutyl benzene-1,2-dicarboxylate;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 21326814 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | dibutyl benzene-1,2-dicarboxylate;2-(2-hydroxyethoxy)ethanol |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCCCC.OCCOCCO |
| InChI | InChI=1S/C16H22O4.C4H10O3/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2;5-1-3-7-4-2-6/h7-10H,3-6,11-12H2,1-2H3;5-6H,1-4H2 |
| InChIKey | HKFXWKHAEFWJGE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|