About ethene;2-octoxycarbonylbenzoic acid
ethene;2-octoxycarbonylbenzoic acid (PubChem CID 157320546) has the molecular formula C18H26O4
and a molecular weight of 306.40 g/mol. Its IUPAC name is ethene;2-octoxycarbonylbenzoic acid.
Molecular Properties
| Compound Name | ethene;2-octoxycarbonylbenzoic acid |
| PubChem CID | 157320546 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | ethene;2-octoxycarbonylbenzoic acid |
| SMILES | C=C.CCCCCCCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H22O4.C2H4/c1-2-3-4-5-6-9-12-20-16(19)14-11-8-7-10-13(14)15(17)18;1-2/h7-8,10-11H,2-6,9,12H2,1H3,(H,17,18);1-2H2 |
| InChIKey | BECOMPUUNFJYPZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-octoxycarbonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-octoxycarbonylbenzoic acid?
The IUPAC name of ethene;2-octoxycarbonylbenzoic acid (CID 157320546) is ethene;2-octoxycarbonylbenzoic acid.
What is the SMILES notation for ethene;2-octoxycarbonylbenzoic acid?
The canonical SMILES for ethene;2-octoxycarbonylbenzoic acid is C=C.CCCCCCCCOC(=O)c1ccccc1C(=O)O.
What is the InChIKey of ethene;2-octoxycarbonylbenzoic acid?
The InChIKey is BECOMPUUNFJYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4.C2H4/c1-2-3-4-5-6-9-12-20-16(19)14-11-8-7-10-13(14)15(17)18;1-2/h7-8,10-11H,2-6,9,12H2,1H3,(H,17,18);1-2H2.
What are the key properties of ethene;2-octoxycarbonylbenzoic acid?
ethene;2-octoxycarbonylbenzoic acid has a molecular weight of 306.40 g/mol, XLogP of 4.70, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-octoxycarbonylbenzoic acid is sourced from PubChem (CID 157320546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).