C16H21IO4 — CID 23502266
2-O-ethyl 1-O-(4-methylpentyl) 4-iodobenzene-1,2-dicarboxylate (PubChem CID 23502266) has the molecular formula C16H21IO4 and a molecular weight of 404.24 g/mol. Its IUPAC name is 2-O-ethyl 1-O-(4-methylpentyl) 4-iodobenzene-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-(4-methylpentyl) 4-iodobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23502266 |
| Molecular Formula | C16H21IO4 |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-O-ethyl 1-O-(4-methylpentyl) 4-iodobenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1cc(I)ccc1C(=O)OCCCC(C)C |
| InChI | InChI=1S/C16H21IO4/c1-4-20-16(19)14-10-12(17)7-8-13(14)15(18)21-9-5-6-11(2)3/h7-8,10-11H,4-6,9H2,1-3H3 |
| InChIKey | NXHGGOALLSPSII-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|