C30H50O4 — CID 23502274
bis(8-methylnonyl) 4-ethylbenzene-1,2-dicarboxylate (PubChem CID 23502274) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is bis(8-methylnonyl) 4-ethylbenzene-1,2-dicarboxylate.
| Compound Name | bis(8-methylnonyl) 4-ethylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23502274 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | bis(8-methylnonyl) 4-ethylbenzene-1,2-dicarboxylate |
| SMILES | CCc1ccc(C(=O)OCCCCCCCC(C)C)c(C(=O)OCCCCCCCC(C)C)c1 |
| InChI | InChI=1S/C30H50O4/c1-6-26-19-20-27(29(31)33-21-15-11-7-9-13-17-24(2)3)28(23-26)30(32)34-22-16-12-8-10-14-18-25(4)5/h19-20,23-25H,6-18,21-22H2,1-5H3 |
| InChIKey | VXPRKCVNGSDDDC-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|