About Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate
Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate (PubChem CID 23502171) has the molecular formula C28H46O4
and a molecular weight of 446.70 g/mol. Its IUPAC name is bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate |
| PubChem CID | 23502171 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate |
| SMILES | CC(C)CCCCCOC(=O)C1=C(C=C(C=C1)C(C)(C)C)C(=O)OCCCCCC(C)C |
| InChI | InChI=1S/C28H46O4/c1-21(2)14-10-8-12-18-31-26(29)24-17-16-23(28(5,6)7)20-25(24)27(30)32-19-13-9-11-15-22(3)4/h16-17,20-22H,8-15,18-19H2,1-7H3 |
| InChIKey | VTPDRMJAEDKCIN-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | 532 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate?
The IUPAC name of Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate (CID 23502171) is bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate.
What is the SMILES notation for Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate?
The canonical SMILES for Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate is CC(C)CCCCCOC(=O)C1=C(C=C(C=C1)C(C)(C)C)C(=O)OCCCCCC(C)C.
What is the InChIKey of Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate?
The InChIKey is VTPDRMJAEDKCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H46O4/c1-21(2)14-10-8-12-18-31-26(29)24-17-16-23(28(5,6)7)20-25(24)27(30)32-19-13-9-11-15-22(3)4/h16-17,20-22H,8-15,18-19H2,1-7H3.
What are the key properties of Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate?
Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate has a molecular weight of 446.70 g/mol, XLogP of 9.60, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Bis(6-methylheptyl) 4-tert-butylbenzene-1,2-dicarboxylate is sourced from PubChem (CID 23502171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).