C24H36BrClO4 — CID 23502222
bis(6-methylheptyl) 4-bromo-5-chlorobenzene-1,2-dicarboxylate (PubChem CID 23502222) has the molecular formula C24H36BrClO4 and a molecular weight of 503.91 g/mol. Its IUPAC name is bis(6-methylheptyl) 4-bromo-5-chlorobenzene-1,2-dicarboxylate.
| Compound Name | bis(6-methylheptyl) 4-bromo-5-chlorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23502222 |
| Molecular Formula | C24H36BrClO4 |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | bis(6-methylheptyl) 4-bromo-5-chlorobenzene-1,2-dicarboxylate |
| SMILES | CC(C)CCCCCOC(=O)c1cc(Cl)c(Br)cc1C(=O)OCCCCCC(C)C |
| InChI | InChI=1S/C24H36BrClO4/c1-17(2)11-7-5-9-13-29-23(27)19-15-21(25)22(26)16-20(19)24(28)30-14-10-6-8-12-18(3)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | SNTAYKLZLYJKEA-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|