C33H50O4 — CID 174765738
bis(7-methyloctyl) benzene-1,2-dicarboxylate;toluene (PubChem CID 174765738) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is bis(7-methyloctyl) benzene-1,2-dicarboxylate;toluene.
| Compound Name | bis(7-methyloctyl) benzene-1,2-dicarboxylate;toluene |
|---|---|
| PubChem CID | 174765738 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | bis(7-methyloctyl) benzene-1,2-dicarboxylate;toluene |
| SMILES | CC(C)CCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCC(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C26H42O4.C7H8/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4;1-7-5-3-2-4-6-7/h11-12,17-18,21-22H,5-10,13-16,19-20H2,1-4H3;2-6H,1H3 |
| InChIKey | TZINJSNQFCMTOO-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|