C36H52O8 — CID 160766825
bis(4-methylpentyl) benzene-1,2-dicarboxylate;dibutyl benzene-1,2-dicarboxylate (PubChem CID 160766825) has the molecular formula C36H52O8 and a molecular weight of 612.80 g/mol. Its IUPAC name is bis(4-methylpentyl) benzene-1,2-dicarboxylate;dibutyl benzene-1,2-dicarboxylate.
| Compound Name | bis(4-methylpentyl) benzene-1,2-dicarboxylate;dibutyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 160766825 |
| Molecular Formula | C36H52O8 |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | bis(4-methylpentyl) benzene-1,2-dicarboxylate;dibutyl benzene-1,2-dicarboxylate |
| SMILES | CC(C)CCCOC(=O)c1ccccc1C(=O)OCCCC(C)C.CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| InChI | InChI=1S/C20H30O4.C16H22O4/c1-15(2)9-7-13-23-19(21)17-11-5-6-12-18(17)20(22)24-14-8-10-16(3)4;1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h5-6,11-12,15-16H,7-10,13-14H2,1-4H3;7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | RYUCIZCKDZIRLA-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|