C22H34O4 — CID 6423648
1-O-(4-methylpentyl) 2-O-octan-4-yl benzene-1,2-dicarboxylate (PubChem CID 6423648) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-O-(4-methylpentyl) 2-O-octan-4-yl benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(4-methylpentyl) 2-O-octan-4-yl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423648 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 1-O-(4-methylpentyl) 2-O-octan-4-yl benzene-1,2-dicarboxylate |
| SMILES | CCCCC(CCC)OC(=O)c1ccccc1C(=O)OCCCC(C)C |
| InChI | InChI=1S/C22H34O4/c1-5-7-13-18(11-6-2)26-22(24)20-15-9-8-14-19(20)21(23)25-16-10-12-17(3)4/h8-9,14-15,17-18H,5-7,10-13,16H2,1-4H3 |
| InChIKey | CJINTIRBFQIOFR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|