C23H32O4 — CID 6423634
1-O-(4-methylpentyl) 2-O-non-5-yn-3-yl benzene-1,2-dicarboxylate (PubChem CID 6423634) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-O-(4-methylpentyl) 2-O-non-5-yn-3-yl benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(4-methylpentyl) 2-O-non-5-yn-3-yl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423634 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-O-(4-methylpentyl) 2-O-non-5-yn-3-yl benzene-1,2-dicarboxylate |
| SMILES | CCCC#CCC(CC)OC(=O)c1ccccc1C(=O)OCCCC(C)C |
| InChI | InChI=1S/C23H32O4/c1-5-7-8-9-14-19(6-2)27-23(25)21-16-11-10-15-20(21)22(24)26-17-12-13-18(3)4/h10-11,15-16,18-19H,5-7,12-14,17H2,1-4H3 |
| InChIKey | QOUYPVNDPJOMGF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|