C47H66O8 — CID 90184870
2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;bis(8-methylnonyl) benzene-1,2-dicarboxylate (PubChem CID 90184870) has the molecular formula C47H66O8 and a molecular weight of 759.04 g/mol. Its IUPAC name is 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;bis(8-methylnonyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;bis(8-methylnonyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90184870 |
| Molecular Formula | C47H66O8 |
| Molecular Weight | 759.04 g/mol |
| Exact Mass | 758.48 |
| IUPAC Name | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;bis(8-methylnonyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC(C)C.CCCCOC(=O)c1ccccc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H46O4.C19H20O4/c1-23(2)17-11-7-5-9-15-21-31-27(29)25-19-13-14-20-26(25)28(30)32-22-16-10-6-8-12-18-24(3)4;1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h13-14,19-20,23-24H,5-12,15-18,21-22H2,1-4H3;4-12H,2-3,13-14H2,1H3 |
| InChIKey | PHFUESSDDIIWBC-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.04 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|