C33H38O8 — CID 158248941
2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dipropyl benzene-1,2-dicarboxylate (PubChem CID 158248941) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dipropyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dipropyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 158248941 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dipropyl benzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCc1ccccc1.CCCOC(=O)c1ccccc1C(=O)OCCC |
| InChI | InChI=1S/C19H20O4.C14H18O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15;1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h4-12H,2-3,13-14H2,1H3;5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | GGLXVBYLKHSVJI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|