C19H20O4 — CID 169434204
2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuterio(1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate (PubChem CID 169434204) has the molecular formula C19H20O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuterio(1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuterio(1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169434204 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuterio(1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate |
| SMILES | [2H][13c]1[13c]([2H])[13c]([2H])[13c](C(=O)OCc2ccccc2)[13c](C(=O)OCCCC)[13c]1[2H] |
| InChI | InChI=1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3/i7+1D,8+1D,11+1D,12+1D,16+1,17+1 |
| InChIKey | IRIAEXORFWYRCZ-QAPMHTEASA-N |
| XLogP | 4.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|