C24H28O6 — CID 69232058
4-O-benzyl 1-O,2-O-dibutyl benzene-1,2,4-tricarboxylate (PubChem CID 69232058) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is 4-O-benzyl 1-O,2-O-dibutyl benzene-1,2,4-tricarboxylate.
| Compound Name | 4-O-benzyl 1-O,2-O-dibutyl benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 69232058 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 4-O-benzyl 1-O,2-O-dibutyl benzene-1,2,4-tricarboxylate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)OCc2ccccc2)cc1C(=O)OCCCC |
| InChI | InChI=1S/C24H28O6/c1-3-5-14-28-23(26)20-13-12-19(16-21(20)24(27)29-15-6-4-2)22(25)30-17-18-10-8-7-9-11-18/h7-13,16H,3-6,14-15,17H2,1-2H3 |
| InChIKey | KEYWIWAELFKIMT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|