C66H108O12 — CID 517693
triheptyl benzene-1,2,4-tricarboxylate;trinonyl benzene-1,2,4-tricarboxylate (PubChem CID 517693) has the molecular formula C66H108O12 and a molecular weight of 1093.58 g/mol. Its IUPAC name is triheptyl benzene-1,2,4-tricarboxylate;trinonyl benzene-1,2,4-tricarboxylate.
| Compound Name | triheptyl benzene-1,2,4-tricarboxylate;trinonyl benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 517693 |
| Molecular Formula | C66H108O12 |
| Molecular Weight | 1093.58 g/mol |
| Exact Mass | 1092.78 |
| IUPAC Name | triheptyl benzene-1,2,4-tricarboxylate;trinonyl benzene-1,2,4-tricarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccc(C(=O)OCCCCCCCCC)c(C(=O)OCCCCCCCCC)c1.CCCCCCCOC(=O)c1ccc(C(=O)OCCCCCCC)c(C(=O)OCCCCCCC)c1 |
| InChI | InChI=1S/C36H60O6.C30H48O6/c1-4-7-10-13-16-19-22-27-40-34(37)31-25-26-32(35(38)41-28-23-20-17-14-11-8-5-2)33(30-31)36(39)42-29-24-21-18-15-12-9-6-3;1-4-7-10-13-16-21-34-28(31)25-19-20-26(29(32)35-22-17-14-11-8-5-2)27(24-25)30(33)36-23-18-15-12-9-6-3/h25-26,30H,4-24,27-29H2,1-3H3;19-20,24H,4-18,21-23H2,1-3H3 |
| InChIKey | SJQOXFJUEFCVRX-UHFFFAOYSA-N |
| XLogP | 18.48 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.58 |
| LogP ≤ 5 | 18.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|