C15H16O6-2 — CID 71442317
4-hexoxycarbonylbenzene-1,3-dicarboxylate (PubChem CID 71442317) has the molecular formula C15H16O6-2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-hexoxycarbonylbenzene-1,3-dicarboxylate.
| Compound Name | 4-hexoxycarbonylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71442317 |
| Molecular Formula | C15H16O6-2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-hexoxycarbonylbenzene-1,3-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1ccc(C(=O)[O-])cc1C(=O)[O-] |
| InChI | InChI=1S/C15H18O6/c1-2-3-4-5-8-21-15(20)11-7-6-10(13(16)17)9-12(11)14(18)19/h6-7,9H,2-5,8H2,1H3,(H,16,17)(H,18,19)/p-2 |
| InChIKey | JAAJWWMAWJICOM-UHFFFAOYSA-L |
| XLogP | 0.15 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|