C26H26O11 — CID 19380076
4-butoxycarbonyl-3-(2-butoxycarbonyl-5-carboxybenzoyl)oxycarbonylbenzoic acid (PubChem CID 19380076) has the molecular formula C26H26O11 and a molecular weight of 514.48 g/mol. Its IUPAC name is 4-butoxycarbonyl-3-(2-butoxycarbonyl-5-carboxybenzoyl)oxycarbonylbenzoic acid.
| Compound Name | 4-butoxycarbonyl-3-(2-butoxycarbonyl-5-carboxybenzoyl)oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 19380076 |
| Molecular Formula | C26H26O11 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 4-butoxycarbonyl-3-(2-butoxycarbonyl-5-carboxybenzoyl)oxycarbonylbenzoic acid |
| SMILES | CCCCOC(=O)c1ccc(C(=O)O)cc1C(=O)OC(=O)c1cc(C(=O)O)ccc1C(=O)OCCCC |
| InChI | InChI=1S/C26H26O11/c1-3-5-11-35-23(31)17-9-7-15(21(27)28)13-19(17)25(33)37-26(34)20-14-16(22(29)30)8-10-18(20)24(32)36-12-6-4-2/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | DTALHHXOBVVATE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 170.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|