C23H21ClO11 — CID 90281183
1-chloropentane;4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid (PubChem CID 90281183) has the molecular formula C23H21ClO11 and a molecular weight of 508.86 g/mol. Its IUPAC name is 1-chloropentane;4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid.
| Compound Name | 1-chloropentane;4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 90281183 |
| Molecular Formula | C23H21ClO11 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 1-chloropentane;4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid |
| SMILES | CCCCCCl.O=C(O)c1ccc(C(=O)OC(=O)c2ccc(C(=O)O)cc2C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H10O11.C5H11Cl/c19-13(20)7-1-3-9(11(5-7)15(23)24)17(27)29-18(28)10-4-2-8(14(21)22)6-12(10)16(25)26;1-2-3-4-5-6/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26);2-5H2,1H3 |
| InChIKey | UZHAFXFDFYCTFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|