C50H54O14 — CID 159562956
dibenzyl 4-hydroxybenzene-1,2-dicarboxylate;dihexyl 4-hydroxybenzene-1,2-dicarboxylate;phthalic acid (PubChem CID 159562956) has the molecular formula C50H54O14 and a molecular weight of 878.97 g/mol. Its IUPAC name is dibenzyl 4-hydroxybenzene-1,2-dicarboxylate;dihexyl 4-hydroxybenzene-1,2-dicarboxylate;phthalic acid.
| Compound Name | dibenzyl 4-hydroxybenzene-1,2-dicarboxylate;dihexyl 4-hydroxybenzene-1,2-dicarboxylate;phthalic acid |
|---|---|
| PubChem CID | 159562956 |
| Molecular Formula | C50H54O14 |
| Molecular Weight | 878.97 g/mol |
| Exact Mass | 878.35 |
| IUPAC Name | dibenzyl 4-hydroxybenzene-1,2-dicarboxylate;dihexyl 4-hydroxybenzene-1,2-dicarboxylate;phthalic acid |
| SMILES | CCCCCCOC(=O)c1ccc(O)cc1C(=O)OCCCCCC.O=C(O)c1ccccc1C(=O)O.O=C(OCc1ccccc1)c1ccc(O)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H18O5.C20H30O5.C8H6O4/c23-18-11-12-19(21(24)26-14-16-7-3-1-4-8-16)20(13-18)22(25)27-15-17-9-5-2-6-10-17;1-3-5-7-9-13-24-19(22)17-12-11-16(21)15-18(17)20(23)25-14-10-8-6-4-2;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-13,23H,14-15H2;11-12,15,21H,3-10,13-14H2,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | MGVSJNIOQLYCOR-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.97 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|