C39H46O8 — CID 70136951
2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dicyclohexyl benzene-1,2-dicarboxylate (PubChem CID 70136951) has the molecular formula C39H46O8 and a molecular weight of 642.79 g/mol. Its IUPAC name is 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dicyclohexyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dicyclohexyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70136951 |
| Molecular Formula | C39H46O8 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 2-O-benzyl 1-O-butyl benzene-1,2-dicarboxylate;dicyclohexyl benzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCc1ccccc1.O=C(OC1CCCCC1)c1ccccc1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H26O4.C19H20O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h7-8,13-16H,1-6,9-12H2;4-12H,2-3,13-14H2,1H3 |
| InChIKey | VZLXXVTVCOKXDE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|