C32H50O8 — CID 159265415
cyclohexane-1,2-dicarboxylic acid;dioctyl benzene-1,2-dicarboxylate (PubChem CID 159265415) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol. Its IUPAC name is cyclohexane-1,2-dicarboxylic acid;dioctyl benzene-1,2-dicarboxylate.
| Compound Name | cyclohexane-1,2-dicarboxylic acid;dioctyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 159265415 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | cyclohexane-1,2-dicarboxylic acid;dioctyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.O=C(O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C24H38O4.C8H12O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;9-7(10)5-3-1-2-4-6(5)8(11)12/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | KXAOUKMOJCJUHZ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|