C39H52O8 — CID 67738318
benzyl 2-hydroxybenzoate;butyl 2-cyclohexylacetate;hexyl 2-hydroxybenzoate (PubChem CID 67738318) has the molecular formula C39H52O8 and a molecular weight of 648.84 g/mol. Its IUPAC name is benzyl 2-hydroxybenzoate;butyl 2-cyclohexylacetate;hexyl 2-hydroxybenzoate.
| Compound Name | benzyl 2-hydroxybenzoate;butyl 2-cyclohexylacetate;hexyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 67738318 |
| Molecular Formula | C39H52O8 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | benzyl 2-hydroxybenzoate;butyl 2-cyclohexylacetate;hexyl 2-hydroxybenzoate |
| SMILES | CCCCCCOC(=O)c1ccccc1O.CCCCOC(=O)CC1CCCCC1.O=C(OCc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C14H12O3.C13H18O3.C12H22O2/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11;1-2-3-4-7-10-16-13(15)11-8-5-6-9-12(11)14;1-2-3-9-14-12(13)10-11-7-5-4-6-8-11/h1-9,15H,10H2;5-6,8-9,14H,2-4,7,10H2,1H3;11H,2-10H2,1H3 |
| InChIKey | PALFINHZKZSDBB-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|