About calcium;hydride;tetradecyl 2-hydroxybenzoate
calcium;hydride;tetradecyl 2-hydroxybenzoate (PubChem CID 174852965) has the molecular formula C21H36CaO3
and a molecular weight of 376.59 g/mol. Its IUPAC name is calcium;hydride;tetradecyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | calcium;hydride;tetradecyl 2-hydroxybenzoate |
| PubChem CID | 174852965 |
| Molecular Formula | C21H36CaO3 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | calcium;hydride;tetradecyl 2-hydroxybenzoate |
| SMILES | CCCCCCCCCCCCCCOC(=O)c1ccccc1O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C21H34O3.Ca.2H/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-24-21(23)19-16-13-14-17-20(19)22;;;/h13-14,16-17,22H,2-12,15,18H2,1H3;;;/q;+2;2*-1 |
| InChIKey | DPJRNSHMELFNRL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;tetradecyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;tetradecyl 2-hydroxybenzoate?
The IUPAC name of calcium;hydride;tetradecyl 2-hydroxybenzoate (CID 174852965) is calcium;hydride;tetradecyl 2-hydroxybenzoate.
What is the SMILES notation for calcium;hydride;tetradecyl 2-hydroxybenzoate?
The canonical SMILES for calcium;hydride;tetradecyl 2-hydroxybenzoate is CCCCCCCCCCCCCCOC(=O)c1ccccc1O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;tetradecyl 2-hydroxybenzoate?
The InChIKey is DPJRNSHMELFNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O3.Ca.2H/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-24-21(23)19-16-13-14-17-20(19)22;;;/h13-14,16-17,22H,2-12,15,18H2,1H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;tetradecyl 2-hydroxybenzoate?
calcium;hydride;tetradecyl 2-hydroxybenzoate has a molecular weight of 376.59 g/mol, XLogP of 6.09, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;tetradecyl 2-hydroxybenzoate is sourced from PubChem (CID 174852965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).