C28H44O5 — CID 174368039
bis(8-methylnonyl) 7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-dicarboxylate (PubChem CID 174368039) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is bis(8-methylnonyl) 7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-dicarboxylate.
| Compound Name | bis(8-methylnonyl) 7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 174368039 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | bis(8-methylnonyl) 7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-dicarboxylate |
| SMILES | CC(C)CCCCCCCOC(=O)c1cc2c(cc1C(=O)OCCCCCCCC(C)C)O2 |
| InChI | InChI=1S/C28H44O5/c1-21(2)15-11-7-5-9-13-17-31-27(29)23-19-25-26(33-25)20-24(23)28(30)32-18-14-10-6-8-12-16-22(3)4/h19-22H,5-18H2,1-4H3 |
| InChIKey | GEVAHAXRMQRUHH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|