About butyl 4-bromo-2-iodobenzoate
butyl 4-bromo-2-iodobenzoate (PubChem CID 177237835) has the molecular formula C11H12BrIO2
and a molecular weight of 383.02 g/mol. Its IUPAC name is butyl 4-bromo-2-iodobenzoate.
Molecular Properties
| Compound Name | butyl 4-bromo-2-iodobenzoate |
| PubChem CID | 177237835 |
| Molecular Formula | C11H12BrIO2 |
| Molecular Weight | 383.02 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | butyl 4-bromo-2-iodobenzoate |
| SMILES | CCCCOC(=O)c1ccc(Br)cc1I |
| InChI | InChI=1S/C11H12BrIO2/c1-2-3-6-15-11(14)9-5-4-8(12)7-10(9)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | WRFOODKZCJTMAY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.02 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-bromo-2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-bromo-2-iodobenzoate?
The IUPAC name of butyl 4-bromo-2-iodobenzoate (CID 177237835) is butyl 4-bromo-2-iodobenzoate.
What is the SMILES notation for butyl 4-bromo-2-iodobenzoate?
The canonical SMILES for butyl 4-bromo-2-iodobenzoate is CCCCOC(=O)c1ccc(Br)cc1I.
What is the InChIKey of butyl 4-bromo-2-iodobenzoate?
The InChIKey is WRFOODKZCJTMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrIO2/c1-2-3-6-15-11(14)9-5-4-8(12)7-10(9)13/h4-5,7H,2-3,6H2,1H3.
What are the key properties of butyl 4-bromo-2-iodobenzoate?
butyl 4-bromo-2-iodobenzoate has a molecular weight of 383.02 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-bromo-2-iodobenzoate is sourced from PubChem (CID 177237835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).