C17H26O5Si — CID 91735685
1-O-(2-butoxyethyl) 2-O-trimethylsilyl benzene-1,2-dicarboxylate (PubChem CID 91735685) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-O-(2-butoxyethyl) 2-O-trimethylsilyl benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2-butoxyethyl) 2-O-trimethylsilyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91735685 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-O-(2-butoxyethyl) 2-O-trimethylsilyl benzene-1,2-dicarboxylate |
| SMILES | CCCCOCCOC(=O)c1ccccc1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H26O5Si/c1-5-6-11-20-12-13-21-16(18)14-9-7-8-10-15(14)17(19)22-23(2,3)4/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | AEMHMCNBXYFYNU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|