C19H30O6Si — CID 91694142
2-O-[tert-butyl(dimethyl)silyl] 1-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate (PubChem CID 91694142) has the molecular formula C19H30O6Si and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-O-[tert-butyl(dimethyl)silyl] 1-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91694142 |
| Molecular Formula | C19H30O6Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-O-[tert-butyl(dimethyl)silyl] 1-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate |
| SMILES | COCCOCCOC(=O)c1ccccc1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30O6Si/c1-19(2,3)26(5,6)25-18(21)16-10-8-7-9-15(16)17(20)24-14-13-23-12-11-22-4/h7-10H,11-14H2,1-6H3 |
| InChIKey | LLDGLMXOFJGHRA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|