About 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate
2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate (PubChem CID 107019127) has the molecular formula C13H18O4S
and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate.
Molecular Properties
| Compound Name | 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate |
| PubChem CID | 107019127 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate |
| SMILES | COCCCOCCOC(=O)c1ccccc1S |
| InChI | InChI=1S/C13H18O4S/c1-15-7-4-8-16-9-10-17-13(14)11-5-2-3-6-12(11)18/h2-3,5-6,18H,4,7-10H2,1H3 |
| InChIKey | MSFZAWZEOOSQMQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate?
The IUPAC name of 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate (CID 107019127) is 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate.
What is the SMILES notation for 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate?
The canonical SMILES for 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate is COCCCOCCOC(=O)c1ccccc1S.
What is the InChIKey of 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate?
The InChIKey is MSFZAWZEOOSQMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4S/c1-15-7-4-8-16-9-10-17-13(14)11-5-2-3-6-12(11)18/h2-3,5-6,18H,4,7-10H2,1H3.
What are the key properties of 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate?
2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate has a molecular weight of 270.35 g/mol, XLogP of 2.19, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypropoxy)ethyl 2-sulfanylbenzoate is sourced from PubChem (CID 107019127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).