About 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate (PubChem CID 71446016) has the molecular formula C13H18O5S
and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate |
| PubChem CID | 71446016 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate |
| SMILES | O=C(OCCOCCOCCO)c1ccccc1S |
| InChI | InChI=1S/C13H18O5S/c14-5-6-16-7-8-17-9-10-18-13(15)11-3-1-2-4-12(11)19/h1-4,14,19H,5-10H2 |
| InChIKey | JSYINVXQOVFWNB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate (CID 71446016) is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate is O=C(OCCOCCOCCO)c1ccccc1S.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate?
The InChIKey is JSYINVXQOVFWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5S/c14-5-6-16-7-8-17-9-10-18-13(15)11-3-1-2-4-12(11)19/h1-4,14,19H,5-10H2.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate?
2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate has a molecular weight of 286.35 g/mol, XLogP of 1.16, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-sulfanylbenzoate is sourced from PubChem (CID 71446016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).