About 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol
2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 70560732) has the molecular formula C13H20O7
and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| PubChem CID | 70560732 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | O=C(O)c1ccccc1O.OCCOCCOCCO |
| InChI | InChI=1S/C7H6O3.C6H14O4/c8-6-4-2-1-3-5(6)7(9)10;7-1-3-9-5-6-10-4-2-8/h1-4,8H,(H,9,10);7-8H,1-6H2 |
| InChIKey | UXIRRLFUHQDZDI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol?
The IUPAC name of 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (CID 70560732) is 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
What is the SMILES notation for 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol?
The canonical SMILES for 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol is O=C(O)c1ccccc1O.OCCOCCOCCO.
What is the InChIKey of 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol?
The InChIKey is UXIRRLFUHQDZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C6H14O4/c8-6-4-2-1-3-5(6)7(9)10;7-1-3-9-5-6-10-4-2-8/h1-4,8H,(H,9,10);7-8H,1-6H2.
What are the key properties of 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol?
2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol has a molecular weight of 288.30 g/mol, XLogP of 0.09, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol is sourced from PubChem (CID 70560732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).