About 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate
2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate (PubChem CID 23024567) has the molecular formula C34H34O7
and a molecular weight of 554.64 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate.
Molecular Properties
| Compound Name | 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate |
| PubChem CID | 23024567 |
| Molecular Formula | C34H34O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate |
| SMILES | O=C(OCCOCCOCCOCCOC(=O)c1ccccc1-c1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C34H34O7/c35-33(31-17-9-7-15-29(31)27-11-3-1-4-12-27)40-25-23-38-21-19-37-20-22-39-24-26-41-34(36)32-18-10-8-16-30(32)28-13-5-2-6-14-28/h1-18H,19-26H2 |
| InChIKey | GUDYKYSSAPFUPE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate?
The IUPAC name of 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate (CID 23024567) is 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate.
What is the SMILES notation for 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate?
The canonical SMILES for 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate is O=C(OCCOCCOCCOCCOC(=O)c1ccccc1-c1ccccc1)c1ccccc1-c1ccccc1.
What is the InChIKey of 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate?
The InChIKey is GUDYKYSSAPFUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H34O7/c35-33(31-17-9-7-15-29(31)27-11-3-1-4-12-27)40-25-23-38-21-19-37-20-22-39-24-26-41-34(36)32-18-10-8-16-30(32)28-13-5-2-6-14-28/h1-18H,19-26H2.
What are the key properties of 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate?
2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate has a molecular weight of 554.64 g/mol, XLogP of 6.08, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-(2-phenylbenzoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-phenylbenzoate is sourced from PubChem (CID 23024567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).