About 2-(4-nitroanilino)ethyl 2-phenylbenzoate
2-(4-nitroanilino)ethyl 2-phenylbenzoate (PubChem CID 134092607) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-(4-nitroanilino)ethyl 2-phenylbenzoate.
Molecular Properties
| Compound Name | 2-(4-nitroanilino)ethyl 2-phenylbenzoate |
| PubChem CID | 134092607 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(4-nitroanilino)ethyl 2-phenylbenzoate |
| SMILES | O=C(OCCNc1ccc([N+](=O)[O-])cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H18N2O4/c24-21(20-9-5-4-8-19(20)16-6-2-1-3-7-16)27-15-14-22-17-10-12-18(13-11-17)23(25)26/h1-13,22H,14-15H2 |
| InChIKey | UTJUNOUOSWYJCL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitroanilino)ethyl 2-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitroanilino)ethyl 2-phenylbenzoate?
The IUPAC name of 2-(4-nitroanilino)ethyl 2-phenylbenzoate (CID 134092607) is 2-(4-nitroanilino)ethyl 2-phenylbenzoate.
What is the SMILES notation for 2-(4-nitroanilino)ethyl 2-phenylbenzoate?
The canonical SMILES for 2-(4-nitroanilino)ethyl 2-phenylbenzoate is O=C(OCCNc1ccc([N+](=O)[O-])cc1)c1ccccc1-c1ccccc1.
What is the InChIKey of 2-(4-nitroanilino)ethyl 2-phenylbenzoate?
The InChIKey is UTJUNOUOSWYJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c24-21(20-9-5-4-8-19(20)16-6-2-1-3-7-16)27-15-14-22-17-10-12-18(13-11-17)23(25)26/h1-13,22H,14-15H2.
What are the key properties of 2-(4-nitroanilino)ethyl 2-phenylbenzoate?
2-(4-nitroanilino)ethyl 2-phenylbenzoate has a molecular weight of 362.39 g/mol, XLogP of 4.53, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitroanilino)ethyl 2-phenylbenzoate is sourced from PubChem (CID 134092607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).