C29H26N4O5 — CID 38112705
N-[2-(4-nitroanilino)ethyl]-2-[2-oxo-2-(2-phenylanilino)ethoxy]benzamide (PubChem CID 38112705) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is N-[2-(4-nitroanilino)ethyl]-2-[2-oxo-2-(2-phenylanilino)ethoxy]benzamide.
| Compound Name | N-[2-(4-nitroanilino)ethyl]-2-[2-oxo-2-(2-phenylanilino)ethoxy]benzamide |
|---|---|
| PubChem CID | 38112705 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[2-(4-nitroanilino)ethyl]-2-[2-oxo-2-(2-phenylanilino)ethoxy]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCCNc1ccc([N+](=O)[O-])cc1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C29H26N4O5/c34-28(32-26-12-6-4-10-24(26)21-8-2-1-3-9-21)20-38-27-13-7-5-11-25(27)29(35)31-19-18-30-22-14-16-23(17-15-22)33(36)37/h1-17,30H,18-20H2,(H,31,35)(H,32,34) |
| InChIKey | VFXMMJIEEWUQPZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|