C27H22N4O5 — CID 4942017
N-(4-anilinophenyl)-2-[[2-(4-nitrophenoxy)acetyl]amino]benzamide (PubChem CID 4942017) has the molecular formula C27H22N4O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[[2-(4-nitrophenoxy)acetyl]amino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[[2-(4-nitrophenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 4942017 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-(4-anilinophenyl)-2-[[2-(4-nitrophenoxy)acetyl]amino]benzamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N4O5/c32-26(18-36-23-16-14-22(15-17-23)31(34)35)30-25-9-5-4-8-24(25)27(33)29-21-12-10-20(11-13-21)28-19-6-2-1-3-7-19/h1-17,28H,18H2,(H,29,33)(H,30,32) |
| InChIKey | ZJKJJGOBNQNWAZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|