About 2-(4-nitrophenoxy)-N'-phenylacetohydrazide
2-(4-nitrophenoxy)-N'-phenylacetohydrazide (PubChem CID 739659) has the molecular formula C14H13N3O4
and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N'-phenylacetohydrazide.
Molecular Properties
| Compound Name | 2-(4-nitrophenoxy)-N'-phenylacetohydrazide |
| PubChem CID | 739659 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(4-nitrophenoxy)-N'-phenylacetohydrazide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NNc1ccccc1 |
| InChI | InChI=1S/C14H13N3O4/c18-14(16-15-11-4-2-1-3-5-11)10-21-13-8-6-12(7-9-13)17(19)20/h1-9,15H,10H2,(H,16,18) |
| InChIKey | OUIFYGBOEMKCLS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenoxy)-N'-phenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenoxy)-N'-phenylacetohydrazide?
The IUPAC name of 2-(4-nitrophenoxy)-N'-phenylacetohydrazide (CID 739659) is 2-(4-nitrophenoxy)-N'-phenylacetohydrazide.
What is the SMILES notation for 2-(4-nitrophenoxy)-N'-phenylacetohydrazide?
The canonical SMILES for 2-(4-nitrophenoxy)-N'-phenylacetohydrazide is O=C(COc1ccc([N+](=O)[O-])cc1)NNc1ccccc1.
What is the InChIKey of 2-(4-nitrophenoxy)-N'-phenylacetohydrazide?
The InChIKey is OUIFYGBOEMKCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O4/c18-14(16-15-11-4-2-1-3-5-11)10-21-13-8-6-12(7-9-13)17(19)20/h1-9,15H,10H2,(H,16,18).
What are the key properties of 2-(4-nitrophenoxy)-N'-phenylacetohydrazide?
2-(4-nitrophenoxy)-N'-phenylacetohydrazide has a molecular weight of 287.28 g/mol, XLogP of 2.12, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenoxy)-N'-phenylacetohydrazide is sourced from PubChem (CID 739659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).