C16H17N3O4 — CID 4682607
2-(3,4-dimethylphenoxy)-N'-(4-nitrophenyl)acetohydrazide (PubChem CID 4682607) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N'-(4-nitrophenyl)acetohydrazide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N'-(4-nitrophenyl)acetohydrazide |
|---|---|
| PubChem CID | 4682607 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N'-(4-nitrophenyl)acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNc2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C16H17N3O4/c1-11-3-8-15(9-12(11)2)23-10-16(20)18-17-13-4-6-14(7-5-13)19(21)22/h3-9,17H,10H2,1-2H3,(H,18,20) |
| InChIKey | HRUIMTXKUYGUNQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|