C18H18NO5- — CID 7316235
2-[4-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate (PubChem CID 7316235) has the molecular formula C18H18NO5- and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-[4-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate.
| Compound Name | 2-[4-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 7316235 |
| Molecular Formula | C18H18NO5- |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[4-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenoxy]acetate |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(OCC(=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C18H19NO5/c1-12-3-6-16(9-13(12)2)23-10-17(20)19-14-4-7-15(8-5-14)24-11-18(21)22/h3-9H,10-11H2,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | JWNVQBKKKIBMFI-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |