C18H21N3O3 — CID 18871077
1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-methylphenyl)urea (PubChem CID 18871077) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 18871077 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NNC(=O)COc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-4-7-15(8-5-12)19-18(23)21-20-17(22)11-24-16-9-6-13(2)14(3)10-16/h4-10H,11H2,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | NSGBZUIIBXRXTO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|