C17H18FN3O3 — CID 2978395
1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)urea (PubChem CID 2978395) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 2978395 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-[[2-(3,4-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)urea |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)Nc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C17H18FN3O3/c1-11-3-8-15(9-12(11)2)24-10-16(22)20-21-17(23)19-14-6-4-13(18)5-7-14/h3-9H,10H2,1-2H3,(H,20,22)(H2,19,21,23) |
| InChIKey | IRDNASWYOMSLAO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|