C15H15FN2O — CID 27870039
1-(3,4-dimethylphenyl)-3-(4-fluorophenyl)urea (PubChem CID 27870039) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 27870039 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(4-fluorophenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C15H15FN2O/c1-10-3-6-14(9-11(10)2)18-15(19)17-13-7-4-12(16)5-8-13/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | XACJZNYVAASZGC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |