C15H16N2O3 — CID 108895471
1-(3,5-dihydroxyphenyl)-3-(3,4-dimethylphenyl)urea (PubChem CID 108895471) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-(3,5-dihydroxyphenyl)-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108895471 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(O)cc(O)c2)cc1C |
| InChI | InChI=1S/C15H16N2O3/c1-9-3-4-11(5-10(9)2)16-15(20)17-12-6-13(18)8-14(19)7-12/h3-8,18-19H,1-2H3,(H2,16,17,20) |
| InChIKey | DELDIODUTVQFSZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |